(Top grade) DBE 99% min

DBE 1.Factory supply 2.Appearance:colorless liquid 3.Molecular Formula:CH3OOC(CH2)nCOOCH3 n=2, 3, 4 4.prompt delivery

                                                     DBE 99% min 

Characters:

CAS NO :95481-62-2

Byname :Dibasic Esters

Appearance :colorless transparent liquid

Molecular Formula :CH3OOC(CH2)nCOOCH3 n=2, 3, 4

Molecular Weight : 159

Specification : 

Index Name		Standard	Index Name	Standard
Ester Content%	≥	99.0	Appearance	colorless transparent liquid
Moisture Content%	≤	0.1	Density( 20 °C g/ml)	1.080-1.096
Color No. (APHA)	≤	25	viscosity: 25 °C , cps	2.4
Acid Number (mgKOH/g)	≤	0.15	Distillation Range °C	195-230
refractive index (20 °C )		1.4180	Flash point P-MiοC	100

Uses :used in the automobile patching paint, coating (coil coating, can lacquer, electric appliance and metal coating and so on), latex paint'sfilm former and so on.

Packing : Metal Drum,220kg net weight each drum

Service we can provide:

1.Mixed container,we can mix different items in one container.

2.Quality control,before shipment,free sample for test after shipment,keep sample for 3 years.

3.Prompt shipment with professional documents.

4.Packing as your request,with photo before shipment

any question, welcome here!

 Maria Qian

Henan Allrich Chemical Co., LTD

Room 7F, Block B Fuhua Building, NO 59 Dongda Street, Zheng zhou China.  Tel: 86-371-66396550 Fax: 86-371-86082812

(Top grade) DBE 99% min